![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1965-Gross-Auditory evoked response comparison during counting clicks and reading.pdf | 20-Dec-2018 16:17 | 250K | |
![[ ]](/icons/layout.gif) | 1966-Gross-Changes in auditory evoked response induced by alcohol.pdf | 20-Dec-2018 16:17 | 333K | |
![[ ]](/icons/layout.gif) | 1967-Begleiter-Cortical evoked potentials and psychopathology.pdf | 20-Dec-2018 16:17 | 347K | |
![[ ]](/icons/layout.gif) | 1967-Begleiter-Evoked cortical responses to affective visual stimuli.pdf | 20-Dec-2018 16:17 | 541K | |
![[ ]](/icons/layout.gif) | 1969-Begleiter-Cortical evoked potentials to semantic stimuli.pdf | 20-Dec-2018 16:17 | 580K | |
![[ ]](/icons/layout.gif) | 1969-Begleiter-Evoked potentials.pdf | 20-Dec-2018 16:17 | 267K | |
![[ ]](/icons/layout.gif) | 1969-Begleiter-The effects of awareness on cortical evoked potentials to conditioned affective stimuli.pdf | 20-Dec-2018 16:17 | 674K | |
![[ ]](/icons/layout.gif) | 1970-Branchey-The effect of various doses of alcohol on sleep in the rat.pdf | 20-Dec-2018 16:17 | 423K | |
![[ ]](/icons/layout.gif) | 1971-Beleiter-Electrophysiological changes during stimulus generalization.pdf | 20-Dec-2018 16:17 | 204K | |
![[ ]](/icons/layout.gif) | 1972-Begleiter-Effects of ethanol on evoked potentials in the rat.pdf | 20-Dec-2018 16:17 | 261K | |
![[ ]](/icons/layout.gif) | 1972-Begleiter-The effects of alcohol on the central nervous system in humans.pdf | 20-Dec-2018 16:17 | 5.4M | |
![[ ]](/icons/layout.gif) | 1973-Begleiter-Evoked potentials correlates of expected stimulus intensity.pdf | 20-Dec-2018 16:17 | 210K | |
![[ ]](/icons/layout.gif) | 1973-Begleiter-Recovery function and clinical symptomatology in acute alcoholization and withdrawal.pdf | 20-Dec-2018 16:17 | 1.0M | |
![[ ]](/icons/layout.gif) | 1973-Porjesz-The effects of alcohol on the somatosensory evoked potentials in man.pdf | 20-Dec-2018 16:17 | 690K | |
![[ ]](/icons/layout.gif) | 1974-Begleiter-Excitability cycle of somatosensory evoked potentials during experimental alcoholization and withdrawal.pdf | 20-Dec-2018 16:17 | 420K | |
![[ ]](/icons/layout.gif) | 1974-Begleiter-Propranolol and alcohol consumption in the rat.pdf | 20-Dec-2018 16:17 | 183K | |
![[ ]](/icons/layout.gif) | 1974-Ho-Experimental studies on alcoholism I.pdf | 20-Dec-2018 16:17 | 340K | |
![[ ]](/icons/layout.gif) | 1975-Begleiter-Ethanol consumption subsequent to physical dependence.pdf | 20-Dec-2018 16:17 | 230K | |
![[ ]](/icons/layout.gif) | 1975-Begleiter-Evoked Potential Changes During Ethanol Withdrawal in Rats.pdf | 20-Dec-2018 16:17 | 881K | |
![[ ]](/icons/layout.gif) | 1975-Begleiter-Evoked brain potentials as indicators of decision-making.pdf | 20-Dec-2018 16:17 | 184K | |
![[ ]](/icons/layout.gif) | 1975-Begleiter-On evoked potentials, cognition, and memory.pdf | 20-Dec-2018 16:17 | 470K | |
![[ ]](/icons/layout.gif) | 1975-Porjesz-Alcohol and bilateral evoked brain potentials.pdf | 20-Dec-2018 16:16 | 546K | |
![[ ]](/icons/layout.gif) | 1975-Porjesz-The effects of stimulus expectancy on evoked brain potentials.pdf | 20-Dec-2018 16:16 | 395K | |
![[ ]](/icons/layout.gif) | 1976-Begleiter-Brain excitability subsequent to alcohol withdrawal in rats.pdf | 20-Dec-2018 16:17 | 2.2M | |
![[ ]](/icons/layout.gif) | 1976-Denoble-Response suppression on a mixed schedule of reinforcement during alcohol withdrawal.pdf | 20-Dec-2018 16:16 | 289K | |
![[ ]](/icons/layout.gif) | 1977-Begleiter-Brain and behavior_A biological approach.pdf | 20-Dec-2018 16:17 | 1.9M | |
![[ ]](/icons/layout.gif) | 1977-Begleiter-Neurobiological factors in mental illness.pdf | 20-Dec-2018 16:17 | 2.1M | |
![[ ]](/icons/layout.gif) | 1977-Begleiter-Persistence of brain hyperexcitability following chronic alcohol exposure in rats.pdf | 20-Dec-2018 16:17 | 1.5M | |
![[ ]](/icons/layout.gif) | 1977-DeNoble-Changes in fixed-ratio performance and blood alcohol levels in monkeys.pdf | 20-Dec-2018 16:17 | 458K | |
![[ ]](/icons/layout.gif) | 1978-Denoble-Alcohol self-administration in monkeys.pdf | 20-Dec-2018 16:17 | 596K | |
![[ ]](/icons/layout.gif) | 1979-Begleiter-Persistence of a subacute withdrawal syndrome following chronic ethanol intake.pdf | 20-Dec-2018 16:17 | 652K | |
![[ ]](/icons/layout.gif) | 1979-Begleiter-Visual evoked potentials and affective ratings of semantic stimuli.pdf | 20-Dec-2018 16:17 | 585K | |
![[ ]](/icons/layout.gif) | 1979-Denoble-Impairment of acquisition of a DRL schedule following prolonged ethanol consumption.pdf | 20-Dec-2018 16:17 | 470K | |
![[ ]](/icons/layout.gif) | 1979-Porjesz-Visual evoked potentials and brain dysfunction in chronic alcoholics.pdf | 20-Dec-2018 16:17 | 2.0M | |
![[ ]](/icons/layout.gif) | 1980-Begleiter-Neuroradiological and neurophysiological evidence of brain deficits in chronic alcoholics.pdf | 20-Dec-2018 16:17 | 640K | |
![[ ]](/icons/layout.gif) | 1980-Begleiter-Protracted brain dysfunction after alcohol withdrawal in monkeys.pdf | 20-Dec-2018 16:17 | 676K | |
![[ ]](/icons/layout.gif) | 1980-Porjesz-Cognitive deficits in chronic alcoholics and elderly subjects assessed by evoked brain potentials.pdf | 20-Dec-2018 16:17 | 681K | |
![[ ]](/icons/layout.gif) | 1980-Porjesz-Visual evoked potential correlates of information processing deficits in chronic alcoholics.pdf | 20-Dec-2018 16:17 | 739K | |
![[ ]](/icons/layout.gif) | 1981-Begleiter-Auditory Brainstem Potentials in Chronic Alcoholics.pdf | 20-Dec-2018 16:17 | 247K | |
![[ ]](/icons/layout.gif) | 1981-Begleiter-Brain dysfunction and alcoholism_ problems and prospects.pdf | 20-Dec-2018 16:17 | 249K | |
![[ ]](/icons/layout.gif) | 1981-Begleiter-Ereignisbezogene Hirnpotentiale und Computertomographie bei chronischen Alkoholikern.pdf | 20-Dec-2018 16:17 | 333K | |
![[ ]](/icons/layout.gif) | 1981-Porjesz-Human evoked brain potentials and alcohol.pdf | 20-Dec-2018 16:18 | 1.2M | |
![[ ]](/icons/layout.gif) | 1982-Porjesz-Evoked brain potential deficits in alcoholism and aging.pdf | 20-Dec-2018 16:18 | 1.0M | |
![[ ]](/icons/layout.gif) | 1982-Porjesz-Evoked brain potential differentiation between geriatric subjects and chronic alcoholics with brain dysfunction.pdf | 20-Dec-2018 16:18 | 1.0M | |
![[ ]](/icons/layout.gif) | 1983-Begleiter-P3 and stimulus incentive value.pdf | 20-Dec-2018 16:18 | 615K | |
![[ ]](/icons/layout.gif) | 1983-Brecher-Event-related brain potentials to high-incentive stimuli in unmedicated schizophrenic patients.pdf | 20-Dec-2018 16:18 | 672K | |
![[ ]](/icons/layout.gif) | 1983-Porjesz-Brain Dysfunction and Alcohol.pdf | 20-Dec-2018 16:18 | 3.6M | |
![[ ]](/icons/layout.gif) | 1984-Begleiter-Brain electrophysiology and alcoholism.pdf | 20-Dec-2018 16:18 | 703K | |
![[ ]](/icons/layout.gif) | 1984-Begleiter-Event-Related Brain Potentials in Boys at Risk for Alcoholism.pdf | 20-Dec-2018 16:18 | 323K | |
![[ ]](/icons/layout.gif) | 1984-Rawlings-Multivariate time series discrimination in the spectral domain.pdf | 20-Dec-2018 16:18 | 445K | |
![[ ]](/icons/layout.gif) | 1985-Begleiter-Evoked brain potentials in abstinent alcoholics and boys at risk for alcoholism.pdf | 20-Dec-2018 16:18 | 2.5M | |
![[ ]](/icons/layout.gif) | 1985-Brecher-Brain stem auditory evoked potentials in unmedicated schizophrenic patients.pdf | 20-Dec-2018 16:18 | 177K | |
![[ ]](/icons/layout.gif) | 1985-Porjesz-Human brain electrophysiology and alcoholism.pdf | 20-Dec-2018 16:18 | 3.7M | |
![[ ]](/icons/layout.gif) | 1985-Porjesz-The use of event-related potentials in the study of alcoholism.pdf | 20-Dec-2018 16:17 | 3.5M | |
![[ ]](/icons/layout.gif) | 1986-Begleiter-The P300 component of the event-related brain potential in psychiatric patients.pdf | 20-Dec-2018 16:17 | 538K | |
![[ ]](/icons/layout.gif) | 1986-Rawlings-Spectral methods for principal components analysis of event-related brain potentials.pdf | 20-Dec-2018 16:18 | 863K | |
![[ ]](/icons/layout.gif) | 1987-Begleiter-Auditory brainstem potentials in sons of alcoholic fathers.pdf | 20-Dec-2018 16:18 | 381K | |
![[ ]](/icons/layout.gif) | 1987-Begleiter-Auditory recovery function and P3 in boys at high risk for alcoholism.pdf | 20-Dec-2018 16:18 | 558K | |
![[ ]](/icons/layout.gif) | 1987-Brecher-Late positive component amplitude in schizophrenics and alcoholics in two different paradigms.pdf | 20-Dec-2018 16:18 | 1.4M | |
![[ ]](/icons/layout.gif) | 1987-Brecher-The N2 component of the event-related potential in schizophrenic patients.pdf | 20-Dec-2018 16:18 | 720K | |
![[ ]](/icons/layout.gif) | 1987-Porjesz-Event-related brain potentials to high incentive stimuli in abstinent alcoholics.pdf | 20-Dec-2018 16:18 | 416K | |
![[ ]](/icons/layout.gif) | 1987-Porjesz-Evoked brain potentials and alcoholism.pdf | 20-Dec-2018 16:18 | 1.1M | |
![[ ]](/icons/layout.gif) | 1987-Porjesz-The N2 component of the event-related brain potential in abstinent alcoholics.pdf | 20-Dec-2018 16:18 | 744K | |
![[ ]](/icons/layout.gif) | 1988-Begleiter-Neurophysiological Dysfunction in Alcoholism.pdf | 20-Dec-2018 16:18 | 1.2M | |
![[ ]](/icons/layout.gif) | 1988-Begleiter-Potential biological markers in individuals at high risk for developing alcoholism.pdf | 20-Dec-2018 16:18 | 759K | |
![[ ]](/icons/layout.gif) | 1988-Rawlings-Multivariate spectral methods for the analysis of event-related brain potentials.pdf | 20-Dec-2018 16:18 | 1.3M | |
![[ ]](/icons/layout.gif) | 1990-Begleiter-Event-related potentials in populations at risk for alcoholism.pdf | 20-Dec-2018 16:18 | 847K | |
![[ ]](/icons/layout.gif) | 1990-Begleiter-Neuroelectric processes in individuals at risk for alcoholism.pdf | 20-Dec-2018 16:18 | 664K | |
![[ ]](/icons/layout.gif) | 1990-Porjesz-Event-related potentials in individuals at risk for alcoholism.pdf | 20-Dec-2018 16:18 | 420K | |
![[ ]](/icons/layout.gif) | 1990-Porjesz-Individuals at risk for alcoholism_ Neurophysiological processes.pdf | 20-Dec-2018 16:18 | 3.4M | |
![[ ]](/icons/layout.gif) | 1991-Begleiter-Overview.pdf | 20-Dec-2018 16:18 | 105K | |
![[ ]](/icons/layout.gif) | 1991-Cohen-EEG characteristics in males at risk for alcoholism.pdf | 20-Dec-2018 16:18 | 411K | |
![[ ]](/icons/layout.gif) | 1991-Porjesz-Neurophysiological factors in individuals at risk for alcoholism.pdf | 20-Dec-2018 16:18 | 1.0M | |
![[ ]](/icons/layout.gif) | 1992-Odencrantz-The topographic analysis of model-referenced evoked potential components.pdf | 20-Dec-2018 16:17 | 1.5M | |
![[ ]](/icons/layout.gif) | 1992-Zaninelli-The Tridimensional Personality Questionnaire in males at high and low risk for alcoholism.pdf | 20-Dec-2018 16:17 | 329K | |
![[ ]](/icons/layout.gif) | 1993-Begleiter-A neurophysiologic correlate of visual short-term memory in humans.pdf | 20-Dec-2018 16:17 | 740K | |
![[ ]](/icons/layout.gif) | 1993-Begleiter-Brain electrophysiology in subjects at risk for alcoholism.pdf | 20-Dec-2018 16:17 | 1.0M | |
![[ ]](/icons/layout.gif) | 1993-Cohen-Ethanol-induced alterations in electroencephalographic activity in adult males.pdf | 20-Dec-2018 16:17 | 565K | |
![[ ]](/icons/layout.gif) | 1993-Cohen-The effects of ethanol on EEG activity in males at risk for alcoholism.pdf | 20-Dec-2018 16:17 | 815K | |
![[ ]](/icons/layout.gif) | 1993-Porjesz-Neurophysiological factors associated with alcoholism.pdf | 20-Dec-2018 16:17 | 2.4M | |
![[ ]](/icons/layout.gif) | 1993-Realmuto-Event-related potential evidence of dysfunction in automatic processing in abstinent alcoholics.pdf | 20-Dec-2018 16:17 | 740K | |
![[ ]](/icons/layout.gif) | 1994-Alexander-P300 from an auditory oddball task.pdf | 20-Dec-2018 16:17 | 1.0M | |
![[ ]](/icons/layout.gif) | 1994-Cohen-Visual P300.pdf | 20-Dec-2018 16:17 | 369K | |
![[ ]](/icons/layout.gif) | 1994-Hertz-Event-related potentials to faces.pdf | 20-Dec-2018 16:17 | 833K | |
![[ ]](/icons/layout.gif) | 1994-Wang-Localization of multiple dipole sources of human cerebral potential based on scd and a model selection criterion.pdf | 20-Dec-2018 16:17 | 554K | |
![[ ]](/icons/layout.gif) | 1994-Wang-Multivariate composite estimators.pdf | 20-Dec-2018 16:17 | 554K | |
![[ ]](/icons/layout.gif) | 1994-Wang-Surface energy, its density and distance.pdf | 20-Dec-2018 16:17 | 1.0M | |
![[ ]](/icons/layout.gif) | 1995-Alexander-P300 hemispheric amplitude asymmetries.pdf | 20-Dec-2018 16:17 | 1.4M | |
![[ ]](/icons/layout.gif) | 1995-Begleiter-Event-related brain potentials differentiate priming and recognition to familiar and unfamiliar faces.pdf | 20-Dec-2018 16:17 | 1.0M | |
![[ ]](/icons/layout.gif) | 1995-Begleiter-Neurophysiological phenotypic factors in the development of alcoholism.pdf | 20-Dec-2018 16:17 | 4.9M | |
![[ ]](/icons/layout.gif) | 1995-Begleiter-The collaborative study on the genetics of alcoholism.pdf | 20-Dec-2018 16:17 | 1.4M | |
![[ ]](/icons/layout.gif) | 1995-Chorlian-Measuring electrical activity of the brain.pdf | 20-Dec-2018 16:17 | 3.7M | |
![[ ]](/icons/layout.gif) | 1995-Cohen-Auditory P300 in Young Alcoholics.pdf | 20-Dec-2018 16:17 | 792K | |
![[ ]](/icons/layout.gif) | 1995-Kuperman-Multi-center N400 ERP consistency using a primed and unprimed word paradigm.pdf | 20-Dec-2018 16:17 | 816K | |
![[ ]](/icons/layout.gif) | 1995-Porjesz-Event-related potentials and cognitive function in alcoholism.pdf | 20-Dec-2018 16:17 | 611K | |
![[ ]](/icons/layout.gif) | 1995-Rice-Comparison of direct interview and family history diagnoses of alcohol dependence.pdf | 20-Dec-2018 16:17 | 648K | |
![[ ]](/icons/layout.gif) | 1995-Volkow-Regional brain metabolic response to Lorazepam in subjects at risk for alcoholism.pdf | 20-Dec-2018 16:17 | 1.1M | |
![[ ]](/icons/layout.gif) | 1995-Zhang-Event related potentials during object recognition tasks.pdf | 20-Dec-2018 16:17 | 791K | |
![[ ]](/icons/layout.gif) | 1996-Alexander-Hemispheric differences for P300 amplitude from an auditory oddball task.pdf | 20-Dec-2018 16:17 | 797K | |
![[ ]](/icons/layout.gif) | 1996-Begleiter-1996-Begleiter-The Collaborative Study on the Genetics of Alcoholism.pdf | 20-Dec-2018 16:17 | 2.0M | |
![[ ]](/icons/layout.gif) | 1996-Begleiter-A genomic survey of alcohol dependence and related phenotypes.pdf | 20-Dec-2018 16:17 | 591K | |
![[ ]](/icons/layout.gif) | 1996-Cohen-Temporal recovery of auditory evoked potentials in individuals at risk for alcoholism.pdf | 20-Dec-2018 16:17 | 675K | |
![[ ]](/icons/layout.gif) | 1996-Porjesz-Effect of alcohol on electrophysiological activity of the brain.pdf | 20-Dec-2018 16:17 | 11M | |
![[ ]](/icons/layout.gif) | 1996-Porjesz-Visual P3 as a potential phenotypic marker for alcoholism.pdf | 20-Dec-2018 16:17 | 757K | |
![[ ]](/icons/layout.gif) | 1996-Ramachandran-A simple auditory oddball task in young adult males at high risk for alcoholism.pdf | 20-Dec-2018 16:17 | 814K | |
![[ ]](/icons/layout.gif) | 1996-Samar-Matched Meyer neural wavelets for clinical and experimental analysis of auditory and visual evoked potentials.pdf | 20-Dec-2018 16:14 | 689K | |
![[ ]](/icons/layout.gif) | 1997-Cohen-Neuroelectric correlates of response production and inhibition in individuals at risk to develop alcoholism.pdf | 20-Dec-2018 16:14 | 1.0M | |
![[ ]](/icons/layout.gif) | 1997-Cohen-Neurophysiological correlates of response production and inhibition in alcoholics.pdf | 20-Dec-2018 16:14 | 917K | |
![[ ]](/icons/layout.gif) | 1997-Koziol-A graphical technique for displaying correlation matrices.pdf | 20-Dec-2018 16:14 | 664K | |
![[ ]](/icons/layout.gif) | 1997-Polich-P300 topography of amplitude_latency correlations.pdf | 20-Dec-2018 16:14 | 1.3M | |
![[ ]](/icons/layout.gif) | 1997-Porjesz-Event-related potentials in coa's.pdf | 20-Dec-2018 16:14 | 218K | |
![[ ]](/icons/layout.gif) | 1997-Rohrbaugh-Slow brain potentials in a visual-spatial memory task.pdf | 20-Dec-2018 16:14 | 3.1M | |
![[ ]](/icons/layout.gif) | 1997-Zhang-Do chronic alcoholics have intact implicit memory.pdf | 20-Dec-2018 16:14 | 1.6M | |
![[ ]](/icons/layout.gif) | 1997-Zhang-Electrophysiological evidence of memory impairment in alcoholic patients.pdf | 20-Dec-2018 16:14 | 1.5M | |
![[ ]](/icons/layout.gif) | 1997-Zhang-Is working memory intact in alcoholics.pdf | 20-Dec-2018 16:14 | 1.2M | |
![[ ]](/icons/layout.gif) | 1997-Zhang-Reflection of working memory.pdf | 20-Dec-2018 16:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 1997-Zhang-Visual object priming differs from visual word priming.pdf | 20-Dec-2018 16:14 | 1.9M | |
![[ ]](/icons/layout.gif) | 1998-Begleiter-Quantitative trait loci analysis of human event-related brain potentials.pdf | 20-Dec-2018 16:13 | 142K | |
![[ ]](/icons/layout.gif) | 1998-Bierut-Linkage of an alcoholism-related severity phenotype to chromosome 16.pdf | 20-Dec-2018 16:13 | 232K | |
![[ ]](/icons/layout.gif) | 1998-Cloniger-Anxiety Proneness linked to epistatic loci in genome scan of human personality traits.pdf | 20-Dec-2018 16:13 | 609K | |
![[ ]](/icons/layout.gif) | 1998-Cohen-Effects of Ethanol on Temporal Recovery of Auditory-Evoked Potentials in Individuals at Risk for Alcoholism.pdf | 20-Dec-2018 16:13 | 1.0M | |
![[ ]](/icons/layout.gif) | 1998-Edenberg-A family-based analysis of the association of the dopamine D2 receptor (DRD2) with alcoholism.pdf | 20-Dec-2018 16:14 | 891K | |
![[ ]](/icons/layout.gif) | 1998-Edenberg-A family-based analysis of whether the functional promoter alleles of the serotonin transporter gene HTT affect the risk for alcohol dependence.pdf | 20-Dec-2018 16:14 | 676K | |
![[ ]](/icons/layout.gif) | 1998-Edenberg-Genetics of Alcoholism.pdf | 20-Dec-2018 16:14 | 241K | |
![[ ]](/icons/layout.gif) | 1998-Foroud-Linkage of an alcoholism-related severity phenotype to chromosome 16.pdf | 20-Dec-2018 16:14 | 903K | |
![[ ]](/icons/layout.gif) | 1998-Ji-ERP components in category matching tasks.pdf | 20-Dec-2018 16:14 | 1.0M | |
![[ ]](/icons/layout.gif) | 1998-Ji-Event-related potentials during digit recognition tasks.pdf | 20-Dec-2018 16:14 | 912K | |
![[ ]](/icons/layout.gif) | 1998-Porjesz-Amplitude of visual P3 event-related potential as a phenotypic marker for a predisposition to alcoholism.pdf | 20-Dec-2018 16:14 | 812K | |
![[ ]](/icons/layout.gif) | 1998-Porjesz-Genetic Basis of Event-related potentials and their relationship to alcoholism and alcohol use.pdf | 20-Dec-2018 16:14 | 1.4M | |
![[ ]](/icons/layout.gif) | 1998-Reich-Genome-wide search for genes affecting the risk for alcohol dependence.pdf | 20-Dec-2018 16:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 1998-Wang-Analysis of repeated measurements in curves (brain potentials).pdf | 20-Dec-2018 16:14 | 427K | |
![[ ]](/icons/layout.gif) | 1998-Wang-Spatial enhancement of event-related potentials using multiresolution analysis.pdf | 20-Dec-2018 16:14 | 867K | |
![[ ]](/icons/layout.gif) | 1999-Almasy-Heritability of event-related brain potentials in families with a history of alcoholism.pdf | 20-Dec-2018 16:14 | 80K | |
![[ ]](/icons/layout.gif) | 1999-Begleiter-Description of the Genetic Analysis Workshop 11 Collaborative Study on the Genetics of Alcoholism.pdf | 20-Dec-2018 16:14 | 369K | |
![[ ]](/icons/layout.gif) | 1999-Begleiter-What Is Inherited in the Predisposition Toward Alcoholism.pdf | 20-Dec-2018 16:14 | 1.3M | |
![[ ]](/icons/layout.gif) | 1999-Holguin-Visual P3a in Male Alcoholics and Controls.pdf | 20-Dec-2018 16:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 1999-Holguin-Visual P3a in male subjects at high risk for alcoholism.pdf | 20-Dec-2018 16:14 | 234K | |
![[ ]](/icons/layout.gif) | 1999-Ji-Event-related potential index of semantic mnemonic dysfunction in abstinent alcoholics.pdf | 20-Dec-2018 16:13 | 1.0M | |
![[ ]](/icons/layout.gif) | 1999-Ji-P300.pdf | 20-Dec-2018 16:13 | 1.3M | |
![[ ]](/icons/layout.gif) | 1999-Neuman-Evaluation of ADHD typology in three contrasting samples_ a latent class approach.pdf | 20-Dec-2018 16:13 | 709K | |
![[ ]](/icons/layout.gif) | 1999-Stassen-Structural decomposition of genetic diversity in families with alcoholism.pdf | 20-Dec-2018 16:13 | 918K | |
![[ ]](/icons/layout.gif) | 1999-Wang-Local polynomial estimate of surface Laplacian.pdf | 20-Dec-2018 16:13 | 1.8M | |
![[ ]](/icons/layout.gif) | 1999-Williams-Joint multipoint linkage analysis of multivariate qualitative and quantitative traits. II. Alcoholism and event-related potentials.pdf | 20-Dec-2018 16:13 | 300K | |
![[ ]](/icons/layout.gif) | 2000-Anokhin-The P300 brain potential is reduced in smokers.pdf | 20-Dec-2018 16:13 | 47K | |
![[ ]](/icons/layout.gif) | 2000-Begleiter-What is inherited in the predisposition to alcoholism.pdf | 20-Dec-2018 16:13 | 515K | |
![[ ]](/icons/layout.gif) | 2000-Bierut-Family-based study of the association of the dopamine D2 receptor gene (DRD2) with habitual smoking.pdf | 20-Dec-2018 16:13 | 80K | |
![[ ]](/icons/layout.gif) | 2000-Costa-Frontal P300 decrements, alcohol dependence, and antisocial personality disorder.pdf | 20-Dec-2018 16:13 | 95K | |
![[ ]](/icons/layout.gif) | 2000-Foroud-Alcoholism Susceptibility Loci.pdf | 20-Dec-2018 16:13 | 1.2M | |
![[ ]](/icons/layout.gif) | 2000-Hada-Auditory P3a assessment of male alcoholics.pdf | 20-Dec-2018 16:13 | 634K | |
![[ ]](/icons/layout.gif) | 2000-Saccone-A genome screen of maximum number of drinks as an alcoholism phenotype.pdf | 20-Dec-2018 16:13 | 105K | |
![[ ]](/icons/layout.gif) | 2000-Taber-Cortical Inhibition in Alcohol Dependence.pdf | 20-Dec-2018 16:13 | 1.4M | |
![[ ]](/icons/layout.gif) | 2000-Wang-Trilinear modeling of event-related potentialspdf.pdf | 20-Dec-2018 16:13 | 2.3M | |
![[ ]](/icons/layout.gif) | 2001-Almasy-Genetics of event-related brain potentials in response to a semantic priming paradigm in families with a history of alcoholism.pdf | 20-Dec-2018 16:13 | 187K | |
![[ ]](/icons/layout.gif) | 2001-Hada-Auditory P3a deficits in male subjects at high risk for alcoholism.pdf | 20-Dec-2018 16:13 | 3.6M | |
![[ ]](/icons/layout.gif) | 2001-Hesselbrock-P300 event-related potential amplitude as an endophenotype of alcoholism -- evidence from the collaborative study on the genetics of alcoholism.pdf | 20-Dec-2018 16:13 | 149K | |
![[ ]](/icons/layout.gif) | 2001-Prabhu-Visual P3 in female alcoholics.pdf | 20-Dec-2018 16:13 | 682K | |
![[ ]](/icons/layout.gif) | 2001-Wang-Warp-averaging event-related potentials.pdf | 20-Dec-2018 16:13 | 302K | |
![[ ]](/icons/layout.gif) | 2001-Zhang-Mismatch negativity in subjects at high risk for alcoholism.pdf | 20-Dec-2018 16:13 | 103K | |
![[ ]](/icons/layout.gif) | 2002-Ardekani-Functional magnetic resonance imaging of brain activity in the visual oddball task.pdf | 20-Dec-2018 16:13 | 658K | |
![[ ]](/icons/layout.gif) | 2002-Bierut-Defining alcohol-related phenotypes in humans.pdf | 20-Dec-2018 16:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 2002-Cohen-Alcohol-related ERP changes recorded from different modalities.pdf | 20-Dec-2018 16:13 | 4.9M | |
![[ ]](/icons/layout.gif) | 2002-Dick-Suggestive linkage on chromosome 1 for a quantitative alcohol-related phenotype.pdf | 20-Dec-2018 16:13 | 208K | |
![[ ]](/icons/layout.gif) | 2002-Jones-Complexity measures of event related potential surface Laplacian data calculated using the wavelet packet transform.pdf | 20-Dec-2018 16:13 | 253K | |
![[ ]](/icons/layout.gif) | 2002-Porjesz-Linkage and linkage disequilibrium mapping of ERP and EEG phenotypes.pdf | 20-Dec-2018 16:13 | 419K | |
![[ ]](/icons/layout.gif) | 2002-Porjesz-Linkage disequilibrium between the beta frequency of the human EEG and a GABAA receptor gene locus.pdf | 20-Dec-2018 16:13 | 234K | |
![[ ]](/icons/layout.gif) | 2002-Rangaswamy-Beta power in the EEG of alocholics.pdf | 20-Dec-2018 16:13 | 182K | |
![[ ]](/icons/layout.gif) | 2003-Chorlian-Determination of human EEG alpha entrainment ERD.pdf | 20-Dec-2018 16:13 | 2.3M | |
![[ ]](/icons/layout.gif) | 2003-Ghosh-Linkage Mapping of Beta 2 EEG Waves via Non-Parametric Regression.pdf | 20-Dec-2018 16:13 | 96K | |
![[ ]](/icons/layout.gif) | 2003-Porjesz-Alcoholism and human electrophysiology.pdf | 20-Dec-2018 16:15 | 602K | |
![[ ]](/icons/layout.gif) | 2003-Rangaswamy-Theta power in the EEG of alcoholics.pdf | 20-Dec-2018 16:15 | 540K | |
![[ ]](/icons/layout.gif) | 2003-Rice-Alcoholism_ The USA Collaborative Study on the Genetics of Alcoholism (COGA).pdf | 20-Dec-2018 16:15 | 956K | |
![[ ]](/icons/layout.gif) | 2003-Song-Association of GABAA Receptors and Alcohol Dependence and the Effects of Genetic Imprinting.pdf | 20-Dec-2018 16:15 | 90K | |
![[ ]](/icons/layout.gif) | 2003-Suresh-Auditory P3 in Female Alcoholics.pdf | 20-Dec-2018 16:15 | 429K | |
![[ ]](/icons/layout.gif) | 2004-Bierut-A genomic scan for habitual smoking in families of alcoholics.pdf | 20-Dec-2018 16:15 | 113K | |
![[ ]](/icons/layout.gif) | 2004-Dick-A Genome-Wide Screen for Genes Influencing Conduct Disorder.pdf | 20-Dec-2018 16:15 | 119K | |
![[ ]](/icons/layout.gif) | 2004-Dick-Association of GABRG3 with alcohol dependence.pdf | 20-Dec-2018 16:15 | 141K | |
![[ ]](/icons/layout.gif) | 2004-Edenberg-Variations in GABRA2, encoding the alpha 2 subunit of the GABA(A) receptor, are associated with alcohol dependence and with brain oscillations.pdf | 20-Dec-2018 16:15 | 243K | |
![[ ]](/icons/layout.gif) | 2004-Jones-Linkage and linkage disequilibrium of evoked EEG oscillations with CHRM2 receptor gene polymorphisms.pdf | 20-Dec-2018 16:15 | 431K | |
![[ ]](/icons/layout.gif) | 2004-Kamarajan-The role of brain oscillations as functional correlates of cognitive systems.pdf | 20-Dec-2018 16:15 | 1.5M | |
![[ ]](/icons/layout.gif) | 2004-Nurnberger-A Family Study of Alcohol Dependence.pdf | 20-Dec-2018 16:15 | 195K | |
![[ ]](/icons/layout.gif) | 2004-Porjesz-The genetics of oscillations in the human brain.pdf | 20-Dec-2018 16:15 | 2.7M | |
![[ ]](/icons/layout.gif) | 2004-Rangaswamy-A functional MRI study of visual oddball.pdf | 20-Dec-2018 16:15 | 732K | |
![[ ]](/icons/layout.gif) | 2004-Rangaswamy-Resting EEG in offspring of male alcoholics.pdf | 20-Dec-2018 16:15 | 152K | |
![[ ]](/icons/layout.gif) | 2004-Wang-Evidence of common and specific genetic effects.pdf | 20-Dec-2018 16:15 | 155K | |
![[ ]](/icons/layout.gif) | 2005-Corbett-A sex-adjusted and age-adjusted genome screen for nested alcohol dependence diagnoses.pdf | 20-Dec-2018 16:15 | 86K | |
![[ ]](/icons/layout.gif) | 2005-Culverhouse-Long-term stability of alcohol and other substance dependence diagnoses and habitual smoking.pdf | 20-Dec-2018 16:15 | 103K | |
![[ ]](/icons/layout.gif) | 2005-Edenberg-Description of the data from the Collaborative Study on the Genetics of Alcoholism (COGA) and single-nucleotide polymorphism genotyping for Genetic Analysis Workshop 14.pdf | 20-Dec-2018 16:15 | 271K | |
![[ ]](/icons/layout.gif) | 2005-Kamarajan-Alcoholism is a disinhibitory disorder.pdf | 20-Dec-2018 16:15 | 482K | |
![[ ]](/icons/layout.gif) | 2005-Kamarajan-Spatial-anatomical mapping of NoGo-P3 in offspring of alcoholics.pdf | 20-Dec-2018 16:15 | 650K | |
![[ ]](/icons/layout.gif) | 2005-Porjesz-The utility of neurophysiological markers in the study of alcoholism.pdf | 20-Dec-2018 16:15 | 525K | |
![[ ]](/icons/layout.gif) | 2006-ACER journal page-Begleiter memorial.pdf | 20-Dec-2018 16:15 | 117K | |
![[ ]](/icons/layout.gif) | 2006-Agrawal-Association of GABRA2 with Drug Dependence in the Collaborative Study of the Genetics of Alcoholism Sample.pdf | 20-Dec-2018 16:15 | 226K | |
![[ ]](/icons/layout.gif) | 2006-Begleiter-Genetics of human brain oscillations.pdf | 20-Dec-2018 16:15 | 662K | |
![[ ]](/icons/layout.gif) | 2006-Chorlian-Amplitude modulation of gamma band oscillations at alpha frequency produced by photic driving.pdf | 20-Dec-2018 16:15 | 1.2M | |
![[ ]](/icons/layout.gif) | 2006-Diamond-Begleiter Memorial Introduction.pdf | 20-Dec-2018 16:15 | 118K | |
![[ ]](/icons/layout.gif) | 2006-Dick-Endophenotypes successfully lead to gene identification.pdf | 20-Dec-2018 16:15 | 421K | |
![[ ]](/icons/layout.gif) | 2006-Dick-Linkage Analyses of IQ in the Collaborative Study on the Genetics of Alcoholism (COGA) Sample.pdf | 20-Dec-2018 16:15 | 304K | |
![[ ]](/icons/layout.gif) | 2006-Dick-Marital status, alcohol dependence, and GABRA2.pdf | 20-Dec-2018 16:15 | 1.1M | |
![[ ]](/icons/layout.gif) | 2006-Dick-The Role of GABRA2 in Risk for Conduct Disorder and Alcohol and Drug Dependence across Developmental Stages.pdf | 20-Dec-2018 16:15 | 473K | |
![[ ]](/icons/layout.gif) | 2006-Edenberg-Association of alcohol dehydrogenase genes with alcohol dependence.pdf | 20-Dec-2018 16:15 | 430K | |
![[ ]](/icons/layout.gif) | 2006-Edenberg-In Memoriam.pdf | 20-Dec-2018 16:14 | 59K | |
![[ ]](/icons/layout.gif) | 2006-Hayden-Patterns of Regional Brain Activity in Alcohol-Dependent Subjects.pdf | 20-Dec-2018 16:14 | 133K | |
![[ ]](/icons/layout.gif) | 2006-Hinrichs-Functional Variant in a Bitter-Taste Receptor (hTAS2R16) Influences Risk of Alcohol Dependence.pdf | 20-Dec-2018 16:14 | 1.7M | |
![[ ]](/icons/layout.gif) | 2006-Jones-A Cholinergic Receptor Gene (CHRM2) Affects Event-related Oscillations.pdf | 20-Dec-2018 16:14 | 474K | |
![[ ]](/icons/layout.gif) | 2006-Jones-S-transform time-frequency analysis of P300 reveals deficits in individuals diagnosed with alcoholism.pdf | 20-Dec-2018 16:14 | 745K | |
![[ ]](/icons/layout.gif) | 2006-Kalant-Henri Begleiter.pdf | 20-Dec-2018 16:14 | 53K | |
![[ ]](/icons/layout.gif) | 2006-Kamarajan-Event-related oscillations in offspring of alcoholics.pdf | 20-Dec-2018 16:14 | 687K | |
![[ ]](/icons/layout.gif) | 2006-Li-Henri Begleiter 1935?2006.pdf | 20-Dec-2018 16:18 | 54K | |
![[ ]](/icons/layout.gif) | 2006-Li-Memories of Henri Begleiter.pdf | 20-Dec-2018 16:14 | 1.5M | |
![[ ]](/icons/layout.gif) | 2006-Padmanabhapillai-Evoked gamma band response in male adolescent subjects at hight risk for alcoholism during a visual oddball task.pdf | 20-Dec-2018 16:14 | 285K | |
![[ ]](/icons/layout.gif) | 2006-Padmanabhapillai-Suppression of early evoked gamma band response in male alcoholics.pdf | 20-Dec-2018 16:14 | 289K | |
![[ ]](/icons/layout.gif) | 2006-Pfefferbaum-From Rats to Monkeys to Man.pdf | 20-Dec-2018 16:14 | 64K | |
![[ ]](/icons/layout.gif) | 2006-Porjesz-Henri Begleiter.pdf | 20-Dec-2018 16:14 | 58K | |
![[ ]](/icons/layout.gif) | 2006-Volkow-High Levels of Dopamine D2 Receptors.pdf | 20-Dec-2018 16:14 | 360K | |
![[ ]](/icons/layout.gif) | 2006-Wang-Genetic Linkage and Linkage Disequilibrium Analysis.pdf | 20-Dec-2018 16:14 | 1.1M | |
![[ ]](/icons/layout.gif) | 2006-Xuei-Association of the kappa-opioid system with alcohol dependence.pdf | 20-Dec-2018 16:14 | 946K | |
![[ ]](/icons/layout.gif) | 2007-Agrawal-Linkage scan for quantitative traits identifies new regions of interest for substance dependence in the Collaborative Study on the Genetics of Alcoholism (COGA) sample.pdf | 20-Dec-2018 16:15 | 592K | |
![[ ]](/icons/layout.gif) | 2007-Chen-Reduced frontal lobe activity in subjects with high impulsivity and alcoholism.pdf | 20-Dec-2018 16:15 | 702K | |
![[ ]](/icons/layout.gif) | 2007-Chorlian-Heritability of EEG coherence in a large sib-pair population.pdf | 20-Dec-2018 16:15 | 487K | |
![[ ]](/icons/layout.gif) | 2007-Dick-Family-Based Association Analyses of Alcohol Dependence Phenotypes Across DRD2 and Neighboring Gene ANKK1.pdf | 20-Dec-2018 16:15 | 310K | |
![[ ]](/icons/layout.gif) | 2007-Edenberg-Association of NFKB1, which encodes a subunit of the transcription factor NF-{kappa}B, with Alcohol Dependence.pdf | 20-Dec-2018 16:15 | 283K | |
![[ ]](/icons/layout.gif) | 2007-Foroud-Association of Alcohol Craving With a-Synuclein (SNCA).pdf | 20-Dec-2018 16:15 | 211K | |
![[ ]](/icons/layout.gif) | 2007-Porjesz-Impulsivity and addiction_ a tribute to Henri Begleiter.pdf | 20-Dec-2018 16:15 | 44K | |
![[ ]](/icons/layout.gif) | 2007-Porjesz-Neurophysiological endophenotypes, CNS disinhibition, and risk for alcohol dependence and related disorders.pdf | 20-Dec-2018 16:15 | 1.8M | |
![[ ]](/icons/layout.gif) | 2007-Porjesz-Professor Henri Begleiter.pdf | 20-Dec-2018 16:14 | 203K | |
![[ ]](/icons/layout.gif) | 2007-Rangaswamy-Delta and theta oscillations as risk markers in adolescent offspring of alcoholics.pdf | 20-Dec-2018 16:14 | 674K | |
![[ ]](/icons/layout.gif) | 2007-Tang-Genetic influences on bipolar EEG power spectra.pdf | 20-Dec-2018 16:14 | 1.4M | |
![[ ]](/icons/layout.gif) | 2007-Tang-Heritability of bipolar EEG spectra in a large sib-pair population.pdf | 20-Dec-2018 16:14 | 316K | |
![[ ]](/icons/layout.gif) | 2008-Agrawal-Linkage scan for quantitative traits identifies new regions of interest for substance dependence in the Collaborative Study on the Genetics of Alcoholism (COGA) sample.pdf | 20-Dec-2018 16:14 | 592K | |
![[ ]](/icons/layout.gif) | 2008-Beirut-Variants in Nicotinic Receptors and Risk for Nicotine Dependence.pdf | 20-Dec-2018 16:14 | 350K | |
![[ ]](/icons/layout.gif) | 2008-Dick-A Systematic Single Nucleotide Polymorphism Screen to Fine-Map Alcohol Dependence Genes on Chromosome 7 Identifies Association With a Novel Susceptibility Gene ACN9.pdf | 20-Dec-2018 16:14 | 1.0M | |
![[ ]](/icons/layout.gif) | 2008-Dick-Using dimensional models of externalizing psychopathology to aid in gene identification.pdf | 20-Dec-2018 16:14 | 138K | |
![[ ]](/icons/layout.gif) | 2008-Edenberg-Association of NFKB1, which encodes a subunit of the transcription factor NF- kappa B, with alcohol dependence.pdf | 20-Dec-2018 16:16 | 364K | |
![[ ]](/icons/layout.gif) | 2008-Grucza-A Risk Allele for Nicotine Dependence in CHRNA5 Is a Protective Allele for Cocaine Dependence.pdf | 20-Dec-2018 16:16 | 139K | |
![[ ]](/icons/layout.gif) | 2017-andersen-polygenicscoresformajordepressive.pdf | 20-Dec-2018 16:13 | 258K | |
![[ ]](/icons/layout.gif) | 2017-chorlian-geneticcorrelatesofthedevelopmentoftheta.pdf | 20-Dec-2018 16:13 | 911K | |
![[ ]](/icons/layout.gif) | 2017-culverhouse-collaborativemetaanalysis.pdf | 20-Dec-2018 16:13 | 1.1M | |
![[ ]](/icons/layout.gif) | 2017-miller-ventralstriatalregulationofcrem.pdf | 20-Dec-2018 16:13 | 888K | |
![[ ]](/icons/layout.gif) | 2017-owusu-polymorphismsinpdlim5.pdf | 20-Dec-2018 16:13 | 659K | |
![[ ]](/icons/layout.gif) | 2017-polimanti-genomewideassociationstudyofbmi.pdf | 20-Dec-2018 16:13 | 550K | |
![[ ]](/icons/layout.gif) | 2017-shuckit-predictorsofalcoholrelatedblackouts.pdf | 20-Dec-2018 16:11 | 147K | |
![[ ]](/icons/layout.gif) | 2019_kranzler_gelernter-gwas_consumption_use-nature_comm.pdf | 22-Apr-2019 12:01 | 1.1M | |
![[ ]](/icons/layout.gif) | 2019_mcclintick_edenberg-ethanol_immune_lymphoblastoid-alcohol.pdf | 22-Apr-2019 12:01 | 427K | |
![[ ]](/icons/layout.gif) | agrawal_nelson-genomewide_association_sudy_cannabis-mol_psychiatry_2018.pdf | 11-Mar-2019 14:05 | 1.0M | |
![[ ]](/icons/layout.gif) | chan.g_2019_a-pilot-follow-up-study_acer.pdf | 29-Oct-2019 14:53 | 312K | |
![[ ]](/icons/layout.gif) | coga-data_publications_cur2.pdf | 29-Aug-2019 14:47 | 352K | |
![[ ]](/icons/layout.gif) | coga-sage_publications_cur.pdf | 14-Jun-2019 12:57 | 563K | |
![[ ]](/icons/layout.gif) | hbnl_publications_latest.pdf | 13-Feb-2019 17:22 | 386K | |
![[ ]](/icons/layout.gif) | hbnl_publications_latest2.pdf | 10-Apr-2019 14:03 | 386K | |
![[ ]](/icons/layout.gif) | johnson.ec_2019_the-genetic-relationship-between_acer.pdf | 29-Oct-2019 14:53 | 293K | |
![[ ]](/icons/layout.gif) | kinreich.s_2019_predicting-risk-for-aud_mol.psychiatry.pdf | 29-Oct-2019 19:28 | 1.1M | |
![[ ]](/icons/layout.gif) | lai.d_2019_genome-wide-association_gbb.pdf | 29-Oct-2019 14:54 | 1.1M | |
![[ ]](/icons/layout.gif) | meyers.jl_2019_association-of-polygenic_brain.sci.pdf | 29-Oct-2019 14:53 | 1.0M | |
![[ ]](/icons/layout.gif) | meyers.jl_2019_early-sexual-trauma.pdf | 29-Oct-2019 14:53 | 845K | |
![[ ]](/icons/layout.gif) | meyers.jl_2019_psychosocial-moderation_transl.psychiatry.pdf | 29-Oct-2019 14:53 | 446K | |
![[ ]](/icons/layout.gif) | meyers_porjesz-trauma_gonogo_theta-j_am_acad_child_adolesc_psychiatry_2019.pdf | 13-Feb-2019 17:16 | 845K | |
![[ ]](/icons/layout.gif) | nurnberger_2019_ext_int_aud_pmid31853508.pdf | 08-Feb-2020 20:43 | 3.8M | |
![[ ]](/icons/layout.gif) | olfson.e_2018_cyp2a6-metabolism-in_addict.biol.pdf | 29-Oct-2019 19:28 | 782K | |
![[ ]](/icons/layout.gif) | polimanti.r_2019_evidence-of-causal_psychol.med.pdf | 29-Oct-2019 14:54 | 422K | |
![[ ]](/icons/layout.gif) | wetherill.l_2018_meta-analyses-of-externalizing_acer.pdf | 29-Oct-2019 19:28 | 2.4M | |
![[ ]](/icons/layout.gif) | wetherill.l_2019_genome-wide-association_gbb.pdf | 29-Oct-2019 14:54 | 3.6M | |
![[ ]](/icons/layout.gif) | yu.d_2019_interrogating-the-genetic_ajp.pdf | 29-Oct-2019 14:54 | 1.2M | |
![[ ]](/icons/layout.gif) | zhang_lu-genetic_heterogeneity_association_nicotine_dependence-2019.pdf | 29-Aug-2019 14:47 | 401K | |
|